| ![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description | 
|---|---|---|---|---|
| ![[PARENTDIR]](/icons/back.gif) | Parent Directory | - | ||
| ![[   ]](/icons/compressed.gif) | charbool.zip | 2023-01-06 10:09 | 1.3K | |
| ![[DIR]](/icons/folder.gif) | charbool/ | 2023-01-06 10:09 | - | |
| ![[   ]](/icons/compressed.gif) | compound.zip | 2023-01-06 10:09 | 1.9K | |
| ![[DIR]](/icons/folder.gif) | compound/ | 2023-01-06 10:09 | - | |
| ![[   ]](/icons/compressed.gif) | dogyears.zip | 2023-01-06 10:09 | 1.8K | |
| ![[DIR]](/icons/folder.gif) | dogyears/ | 2023-01-06 10:09 | - | |
| ![[   ]](/icons/compressed.gif) | gimme.zip | 2023-01-06 10:09 | 228K | |
| ![[DIR]](/icons/folder.gif) | gimme/ | 2023-01-06 10:09 | - | |
| ![[   ]](/icons/compressed.gif) | marks.zip | 2023-01-06 10:09 | 1.7K | |
| ![[DIR]](/icons/folder.gif) | marks/ | 2023-01-06 10:09 | - | |
| ![[   ]](/icons/unknown.gif) | max2.class | 2023-01-06 10:09 | 868 | |
| ![[TXT]](/icons/text.gif) | max2.java | 2023-01-06 10:09 | 436 | |
| ![[   ]](/icons/compressed.gif) | min.zip | 2023-01-06 10:09 | 1.3K | |
| ![[DIR]](/icons/folder.gif) | min/ | 2023-01-06 10:09 | - | |
| ![[   ]](/icons/compressed.gif) | precious.zip | 2023-01-06 10:09 | 1.3K | |
| ![[DIR]](/icons/folder.gif) | precious/ | 2023-01-06 10:09 | - | |
| ![[   ]](/icons/compressed.gif) | quickfox.zip | 2023-01-06 10:09 | 1.7K | |
| ![[DIR]](/icons/folder.gif) | quickfox/ | 2023-01-06 10:09 | - | |
| ![[   ]](/icons/compressed.gif) | test1.zip | 2023-01-06 10:09 | 1.2K | |
| ![[DIR]](/icons/folder.gif) | test1/ | 2023-01-06 10:09 | - | |
| ![[   ]](/icons/compressed.gif) | testnumber.zip | 2023-01-06 10:09 | 1.7K | |
| ![[DIR]](/icons/folder.gif) | testnumber/ | 2023-01-06 10:09 | - | |